C10H19N5O2S — CID 83012354
3-amino-1-ethyl-N-piperidin-1-ylpyrazole-4-sulfonamide (PubChem CID 83012354) has the molecular formula C10H19N5O2S and a molecular weight of 273.36 g/mol. Its IUPAC name is 3-amino-1-ethyl-N-piperidin-1-ylpyrazole-4-sulfonamide.
| Compound Name | 3-amino-1-ethyl-N-piperidin-1-ylpyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 83012354 |
| Molecular Formula | C10H19N5O2S |
| Molecular Weight | 273.36 g/mol |
| Exact Mass | 273.13 |
| IUPAC Name | 3-amino-1-ethyl-N-piperidin-1-ylpyrazole-4-sulfonamide |
| SMILES | CCn1cc(S(=O)(=O)NN2CCCCC2)c(N)n1 |
| InChI | InChI=1S/C10H19N5O2S/c1-2-14-8-9(10(11)12-14)18(16,17)13-15-6-4-3-5-7-15/h8,13H,2-7H2,1H3,(H2,11,12) |
| InChIKey | NVNALBWCDHJUAB-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 93.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.36 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |