C8H13F3N4O2S — CID 60809900
3-amino-1-propyl-N-(2,2,2-trifluoroethyl)pyrazole-4-sulfonamide (PubChem CID 60809900) has the molecular formula C8H13F3N4O2S and a molecular weight of 286.28 g/mol. Its IUPAC name is 3-amino-1-propyl-N-(2,2,2-trifluoroethyl)pyrazole-4-sulfonamide.
| Compound Name | 3-amino-1-propyl-N-(2,2,2-trifluoroethyl)pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 60809900 |
| Molecular Formula | C8H13F3N4O2S |
| Molecular Weight | 286.28 g/mol |
| Exact Mass | 286.07 |
| IUPAC Name | 3-amino-1-propyl-N-(2,2,2-trifluoroethyl)pyrazole-4-sulfonamide |
| SMILES | CCCn1cc(S(=O)(=O)NCC(F)(F)F)c(N)n1 |
| InChI | InChI=1S/C8H13F3N4O2S/c1-2-3-15-4-6(7(12)14-15)18(16,17)13-5-8(9,10)11/h4,13H,2-3,5H2,1H3,(H2,12,14) |
| InChIKey | ZQVYHHSIFXMWOZ-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 90.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.28 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |