C14H26N4O2S — CID 107327983
4-hydrazinyl-2,6-dimethyl-N-[2-[methyl(propan-2-yl)amino]ethyl]benzenesulfonamide (PubChem CID 107327983) has the molecular formula C14H26N4O2S and a molecular weight of 314.46 g/mol. Its IUPAC name is 4-hydrazinyl-2,6-dimethyl-N-[2-[methyl(propan-2-yl)amino]ethyl]benzenesulfonamide.
| Compound Name | 4-hydrazinyl-2,6-dimethyl-N-[2-[methyl(propan-2-yl)amino]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 107327983 |
| Molecular Formula | C14H26N4O2S |
| Molecular Weight | 314.46 g/mol |
| Exact Mass | 314.18 |
| IUPAC Name | 4-hydrazinyl-2,6-dimethyl-N-[2-[methyl(propan-2-yl)amino]ethyl]benzenesulfonamide |
| SMILES | Cc1cc(NN)cc(C)c1S(=O)(=O)NCCN(C)C(C)C |
| InChI | InChI=1S/C14H26N4O2S/c1-10(2)18(5)7-6-16-21(19,20)14-11(3)8-13(17-15)9-12(14)4/h8-10,16-17H,6-7,15H2,1-5H3 |
| InChIKey | PRGYBRHBXKKSQL-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.46 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|