C11H20N4O4S2 — CID 107327862
4-hydrazinyl-N-[2-(methanesulfonamido)ethyl]-2,6-dimethylbenzenesulfonamide (PubChem CID 107327862) has the molecular formula C11H20N4O4S2 and a molecular weight of 336.44 g/mol. Its IUPAC name is 4-hydrazinyl-N-[2-(methanesulfonamido)ethyl]-2,6-dimethylbenzenesulfonamide.
| Compound Name | 4-hydrazinyl-N-[2-(methanesulfonamido)ethyl]-2,6-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 107327862 |
| Molecular Formula | C11H20N4O4S2 |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.09 |
| IUPAC Name | 4-hydrazinyl-N-[2-(methanesulfonamido)ethyl]-2,6-dimethylbenzenesulfonamide |
| SMILES | Cc1cc(NN)cc(C)c1S(=O)(=O)NCCNS(C)(=O)=O |
| InChI | InChI=1S/C11H20N4O4S2/c1-8-6-10(15-12)7-9(2)11(8)21(18,19)14-5-4-13-20(3,16)17/h6-7,13-15H,4-5,12H2,1-3H3 |
| InChIKey | AHZYOKNAMGSEMB-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 130.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|