C14H23N3O2S2 — CID 107328091
4-hydrazinyl-2,6-dimethyl-N-(thian-2-ylmethyl)benzenesulfonamide (PubChem CID 107328091) has the molecular formula C14H23N3O2S2 and a molecular weight of 329.49 g/mol. Its IUPAC name is 4-hydrazinyl-2,6-dimethyl-N-(thian-2-ylmethyl)benzenesulfonamide.
| Compound Name | 4-hydrazinyl-2,6-dimethyl-N-(thian-2-ylmethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 107328091 |
| Molecular Formula | C14H23N3O2S2 |
| Molecular Weight | 329.49 g/mol |
| Exact Mass | 329.12 |
| IUPAC Name | 4-hydrazinyl-2,6-dimethyl-N-(thian-2-ylmethyl)benzenesulfonamide |
| SMILES | Cc1cc(NN)cc(C)c1S(=O)(=O)NCC1CCCCS1 |
| InChI | InChI=1S/C14H23N3O2S2/c1-10-7-12(17-15)8-11(2)14(10)21(18,19)16-9-13-5-3-4-6-20-13/h7-8,13,16-17H,3-6,9,15H2,1-2H3 |
| InChIKey | MBDTYCSBAQSOPF-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.49 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|