About N-(4-aminocyclohexyl)-N,5-dimethylthiophene-2-sulfonamide
N-(4-aminocyclohexyl)-N,5-dimethylthiophene-2-sulfonamide (PubChem CID 79120828) has the molecular formula C12H20N2O2S2
and a molecular weight of 288.44 g/mol. Its IUPAC name is N-(4-aminocyclohexyl)-N,5-dimethylthiophene-2-sulfonamide.
Molecular Properties
| Compound Name | N-(4-aminocyclohexyl)-N,5-dimethylthiophene-2-sulfonamide |
| PubChem CID | 79120828 |
| Molecular Formula | C12H20N2O2S2 |
| Molecular Weight | 288.44 g/mol |
| Exact Mass | 288.10 |
| IUPAC Name | N-(4-aminocyclohexyl)-N,5-dimethylthiophene-2-sulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N(C)C2CCC(N)CC2)s1 |
| InChI | InChI=1S/C12H20N2O2S2/c1-9-3-8-12(17-9)18(15,16)14(2)11-6-4-10(13)5-7-11/h3,8,10-11H,4-7,13H2,1-2H3 |
| InChIKey | YTVAIRWPVMPAPF-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.44 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(4-aminocyclohexyl)-N,5-dimethylthiophene-2-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-aminocyclohexyl)-N,5-dimethylthiophene-2-sulfonamide?
The IUPAC name of N-(4-aminocyclohexyl)-N,5-dimethylthiophene-2-sulfonamide (CID 79120828) is N-(4-aminocyclohexyl)-N,5-dimethylthiophene-2-sulfonamide.
What is the SMILES notation for N-(4-aminocyclohexyl)-N,5-dimethylthiophene-2-sulfonamide?
The canonical SMILES for N-(4-aminocyclohexyl)-N,5-dimethylthiophene-2-sulfonamide is Cc1ccc(S(=O)(=O)N(C)C2CCC(N)CC2)s1.
What is the InChIKey of N-(4-aminocyclohexyl)-N,5-dimethylthiophene-2-sulfonamide?
The InChIKey is YTVAIRWPVMPAPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20N2O2S2/c1-9-3-8-12(17-9)18(15,16)14(2)11-6-4-10(13)5-7-11/h3,8,10-11H,4-7,13H2,1-2H3.
What are the key properties of N-(4-aminocyclohexyl)-N,5-dimethylthiophene-2-sulfonamide?
N-(4-aminocyclohexyl)-N,5-dimethylthiophene-2-sulfonamide has a molecular weight of 288.44 g/mol, XLogP of 1.95, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-aminocyclohexyl)-N,5-dimethylthiophene-2-sulfonamide is sourced from PubChem (CID 79120828), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).