C11H17NO2S2 — CID 718928
1-(2,5-dimethylthiophen-3-yl)sulfonylpiperidine (PubChem CID 718928) has the molecular formula C11H17NO2S2 and a molecular weight of 259.40 g/mol. Its IUPAC name is 1-(2,5-dimethylthiophen-3-yl)sulfonylpiperidine.
| Compound Name | 1-(2,5-dimethylthiophen-3-yl)sulfonylpiperidine |
|---|---|
| PubChem CID | 718928 |
| Molecular Formula | C11H17NO2S2 |
| Molecular Weight | 259.40 g/mol |
| Exact Mass | 259.07 |
| IUPAC Name | 1-(2,5-dimethylthiophen-3-yl)sulfonylpiperidine |
| SMILES | Cc1cc(S(=O)(=O)N2CCCCC2)c(C)s1 |
| InChI | InChI=1S/C11H17NO2S2/c1-9-8-11(10(2)15-9)16(13,14)12-6-4-3-5-7-12/h8H,3-7H2,1-2H3 |
| InChIKey | HIFHUPNPVHXJQQ-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.40 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |