C13H18N2O4S2 — CID 154879885
[4-(2,5-dimethylthiophen-3-yl)sulfonylpiperazin-1-yl]-(oxiran-2-yl)methanone (PubChem CID 154879885) has the molecular formula C13H18N2O4S2 and a molecular weight of 330.43 g/mol. Its IUPAC name is [4-(2,5-dimethylthiophen-3-yl)sulfonylpiperazin-1-yl]-(oxiran-2-yl)methanone.
| Compound Name | [4-(2,5-dimethylthiophen-3-yl)sulfonylpiperazin-1-yl]-(oxiran-2-yl)methanone |
|---|---|
| PubChem CID | 154879885 |
| Molecular Formula | C13H18N2O4S2 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.07 |
| IUPAC Name | [4-(2,5-dimethylthiophen-3-yl)sulfonylpiperazin-1-yl]-(oxiran-2-yl)methanone |
| SMILES | Cc1cc(S(=O)(=O)N2CCN(C(=O)C3CO3)CC2)c(C)s1 |
| InChI | InChI=1S/C13H18N2O4S2/c1-9-7-12(10(2)20-9)21(17,18)15-5-3-14(4-6-15)13(16)11-8-19-11/h7,11H,3-6,8H2,1-2H3 |
| InChIKey | OGJYVSJMHPVXNB-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 70.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|