C11H18N2O2S2 — CID 43556372
1-(2,5-dimethylthiophen-3-yl)sulfonylpiperidin-4-amine (PubChem CID 43556372) has the molecular formula C11H18N2O2S2 and a molecular weight of 274.41 g/mol. Its IUPAC name is 1-(2,5-dimethylthiophen-3-yl)sulfonylpiperidin-4-amine.
| Compound Name | 1-(2,5-dimethylthiophen-3-yl)sulfonylpiperidin-4-amine |
|---|---|
| PubChem CID | 43556372 |
| Molecular Formula | C11H18N2O2S2 |
| Molecular Weight | 274.41 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | 1-(2,5-dimethylthiophen-3-yl)sulfonylpiperidin-4-amine |
| SMILES | Cc1cc(S(=O)(=O)N2CCC(N)CC2)c(C)s1 |
| InChI | InChI=1S/C11H18N2O2S2/c1-8-7-11(9(2)16-8)17(14,15)13-5-3-10(12)4-6-13/h7,10H,3-6,12H2,1-2H3 |
| InChIKey | UQOJEOXDVPAMNC-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.41 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |