C10H13Br2NO2S2 — CID 80672715
4-bromo-1-(5-bromo-2-methylthiophen-3-yl)sulfonylpiperidine (PubChem CID 80672715) has the molecular formula C10H13Br2NO2S2 and a molecular weight of 403.16 g/mol. Its IUPAC name is 4-bromo-1-(5-bromo-2-methylthiophen-3-yl)sulfonylpiperidine.
| Compound Name | 4-bromo-1-(5-bromo-2-methylthiophen-3-yl)sulfonylpiperidine |
|---|---|
| PubChem CID | 80672715 |
| Molecular Formula | C10H13Br2NO2S2 |
| Molecular Weight | 403.16 g/mol |
| Exact Mass | 400.88 |
| IUPAC Name | 4-bromo-1-(5-bromo-2-methylthiophen-3-yl)sulfonylpiperidine |
| SMILES | Cc1sc(Br)cc1S(=O)(=O)N1CCC(Br)CC1 |
| InChI | InChI=1S/C10H13Br2NO2S2/c1-7-9(6-10(12)16-7)17(14,15)13-4-2-8(11)3-5-13/h6,8H,2-5H2,1H3 |
| InChIKey | HGOYBHQTQNATJZ-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.16 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|