C14H20BrNO3S2 — CID 81096789
2-(5-bromo-2-methylthiophen-3-yl)sulfonyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-ol (PubChem CID 81096789) has the molecular formula C14H20BrNO3S2 and a molecular weight of 394.36 g/mol. Its IUPAC name is 2-(5-bromo-2-methylthiophen-3-yl)sulfonyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-ol.
| Compound Name | 2-(5-bromo-2-methylthiophen-3-yl)sulfonyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-ol |
|---|---|
| PubChem CID | 81096789 |
| Molecular Formula | C14H20BrNO3S2 |
| Molecular Weight | 394.36 g/mol |
| Exact Mass | 393.01 |
| IUPAC Name | 2-(5-bromo-2-methylthiophen-3-yl)sulfonyl-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-ol |
| SMILES | Cc1sc(Br)cc1S(=O)(=O)N1CCC2(O)CCCCC2C1 |
| InChI | InChI=1S/C14H20BrNO3S2/c1-10-12(8-13(15)20-10)21(18,19)16-7-6-14(17)5-3-2-4-11(14)9-16/h8,11,17H,2-7,9H2,1H3 |
| InChIKey | QFHOVPLBYSELHZ-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.36 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |