C10H12BrNO4S2 — CID 124517195
(3S)-1-(5-bromo-2-methylthiophen-3-yl)sulfonylpyrrolidine-3-carboxylic acid (PubChem CID 124517195) has the molecular formula C10H12BrNO4S2 and a molecular weight of 354.25 g/mol. Its IUPAC name is (3S)-1-(5-bromo-2-methylthiophen-3-yl)sulfonylpyrrolidine-3-carboxylic acid.
| Compound Name | (3S)-1-(5-bromo-2-methylthiophen-3-yl)sulfonylpyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 124517195 |
| Molecular Formula | C10H12BrNO4S2 |
| Molecular Weight | 354.25 g/mol |
| Exact Mass | 352.94 |
| IUPAC Name | (3S)-1-(5-bromo-2-methylthiophen-3-yl)sulfonylpyrrolidine-3-carboxylic acid |
| SMILES | Cc1sc(Br)cc1S(=O)(=O)N1CC[C@H](C(=O)O)C1 |
| InChI | InChI=1S/C10H12BrNO4S2/c1-6-8(4-9(11)17-6)18(15,16)12-3-2-7(5-12)10(13)14/h4,7H,2-3,5H2,1H3,(H,13,14)/t7-/m0/s1 |
| InChIKey | XJGYIGVUFHMCHA-ZETCQYMHSA-N |
| XLogP | 1.91 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.25 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |