C11H11Br2NO4S — CID 63030797
1-(2,5-dibromophenyl)sulfonylpyrrolidine-3-carboxylic acid (PubChem CID 63030797) has the molecular formula C11H11Br2NO4S and a molecular weight of 413.09 g/mol. Its IUPAC name is 1-(2,5-dibromophenyl)sulfonylpyrrolidine-3-carboxylic acid.
| Compound Name | 1-(2,5-dibromophenyl)sulfonylpyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 63030797 |
| Molecular Formula | C11H11Br2NO4S |
| Molecular Weight | 413.09 g/mol |
| Exact Mass | 410.88 |
| IUPAC Name | 1-(2,5-dibromophenyl)sulfonylpyrrolidine-3-carboxylic acid |
| SMILES | O=C(O)C1CCN(S(=O)(=O)c2cc(Br)ccc2Br)C1 |
| InChI | InChI=1S/C11H11Br2NO4S/c12-8-1-2-9(13)10(5-8)19(17,18)14-4-3-7(6-14)11(15)16/h1-2,5,7H,3-4,6H2,(H,15,16) |
| InChIKey | QOBZSFXLPLQNKC-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.09 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |