C9H9Br2NO3S — CID 63106090
1-(2,5-dibromophenyl)sulfonylazetidin-3-ol (PubChem CID 63106090) has the molecular formula C9H9Br2NO3S and a molecular weight of 371.05 g/mol. Its IUPAC name is 1-(2,5-dibromophenyl)sulfonylazetidin-3-ol.
| Compound Name | 1-(2,5-dibromophenyl)sulfonylazetidin-3-ol |
|---|---|
| PubChem CID | 63106090 |
| Molecular Formula | C9H9Br2NO3S |
| Molecular Weight | 371.05 g/mol |
| Exact Mass | 368.87 |
| IUPAC Name | 1-(2,5-dibromophenyl)sulfonylazetidin-3-ol |
| SMILES | O=S(=O)(c1cc(Br)ccc1Br)N1CC(O)C1 |
| InChI | InChI=1S/C9H9Br2NO3S/c10-6-1-2-8(11)9(3-6)16(14,15)12-4-7(13)5-12/h1-3,7,13H,4-5H2 |
| InChIKey | ANYNBFZJBYJRIO-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.05 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |