C13H17Br2NO2S — CID 47306024
1-(2,5-dibromophenyl)sulfonyl-4-ethylpiperidine (PubChem CID 47306024) has the molecular formula C13H17Br2NO2S and a molecular weight of 411.16 g/mol. Its IUPAC name is 1-(2,5-dibromophenyl)sulfonyl-4-ethylpiperidine.
| Compound Name | 1-(2,5-dibromophenyl)sulfonyl-4-ethylpiperidine |
|---|---|
| PubChem CID | 47306024 |
| Molecular Formula | C13H17Br2NO2S |
| Molecular Weight | 411.16 g/mol |
| Exact Mass | 408.93 |
| IUPAC Name | 1-(2,5-dibromophenyl)sulfonyl-4-ethylpiperidine |
| SMILES | CCC1CCN(S(=O)(=O)c2cc(Br)ccc2Br)CC1 |
| InChI | InChI=1S/C13H17Br2NO2S/c1-2-10-5-7-16(8-6-10)19(17,18)13-9-11(14)3-4-12(13)15/h3-4,9-10H,2,5-8H2,1H3 |
| InChIKey | NXUBULMJROKXLS-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.16 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |