C12H15Br2NO2S2 — CID 113242768
4-(2,5-dibromophenyl)sulfonyl-2-ethylthiomorpholine (PubChem CID 113242768) has the molecular formula C12H15Br2NO2S2 and a molecular weight of 429.20 g/mol. Its IUPAC name is 4-(2,5-dibromophenyl)sulfonyl-2-ethylthiomorpholine.
| Compound Name | 4-(2,5-dibromophenyl)sulfonyl-2-ethylthiomorpholine |
|---|---|
| PubChem CID | 113242768 |
| Molecular Formula | C12H15Br2NO2S2 |
| Molecular Weight | 429.20 g/mol |
| Exact Mass | 426.89 |
| IUPAC Name | 4-(2,5-dibromophenyl)sulfonyl-2-ethylthiomorpholine |
| SMILES | CCC1CN(S(=O)(=O)c2cc(Br)ccc2Br)CCS1 |
| InChI | InChI=1S/C12H15Br2NO2S2/c1-2-10-8-15(5-6-18-10)19(16,17)12-7-9(13)3-4-11(12)14/h3-4,7,10H,2,5-6,8H2,1H3 |
| InChIKey | KNXCZTUOVCGYLB-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.20 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |