C14H20BrNO3S2 — CID 114363321
[4-bromo-3-(2-ethylthiomorpholin-4-yl)sulfonyl-5-methylphenyl]methanol (PubChem CID 114363321) has the molecular formula C14H20BrNO3S2 and a molecular weight of 394.36 g/mol. Its IUPAC name is [4-bromo-3-(2-ethylthiomorpholin-4-yl)sulfonyl-5-methylphenyl]methanol.
| Compound Name | [4-bromo-3-(2-ethylthiomorpholin-4-yl)sulfonyl-5-methylphenyl]methanol |
|---|---|
| PubChem CID | 114363321 |
| Molecular Formula | C14H20BrNO3S2 |
| Molecular Weight | 394.36 g/mol |
| Exact Mass | 393.01 |
| IUPAC Name | [4-bromo-3-(2-ethylthiomorpholin-4-yl)sulfonyl-5-methylphenyl]methanol |
| SMILES | CCC1CN(S(=O)(=O)c2cc(CO)cc(C)c2Br)CCS1 |
| InChI | InChI=1S/C14H20BrNO3S2/c1-3-12-8-16(4-5-20-12)21(18,19)13-7-11(9-17)6-10(2)14(13)15/h6-7,12,17H,3-5,8-9H2,1-2H3 |
| InChIKey | QBVKYCNUBIDDRL-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.36 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |