C13H18BrNO2S2 — CID 115650834
4-(5-bromo-2-methylphenyl)sulfonyl-2-ethylthiomorpholine (PubChem CID 115650834) has the molecular formula C13H18BrNO2S2 and a molecular weight of 364.33 g/mol. Its IUPAC name is 4-(5-bromo-2-methylphenyl)sulfonyl-2-ethylthiomorpholine.
| Compound Name | 4-(5-bromo-2-methylphenyl)sulfonyl-2-ethylthiomorpholine |
|---|---|
| PubChem CID | 115650834 |
| Molecular Formula | C13H18BrNO2S2 |
| Molecular Weight | 364.33 g/mol |
| Exact Mass | 363.00 |
| IUPAC Name | 4-(5-bromo-2-methylphenyl)sulfonyl-2-ethylthiomorpholine |
| SMILES | CCC1CN(S(=O)(=O)c2cc(Br)ccc2C)CCS1 |
| InChI | InChI=1S/C13H18BrNO2S2/c1-3-12-9-15(6-7-18-12)19(16,17)13-8-11(14)5-4-10(13)2/h4-5,8,12H,3,6-7,9H2,1-2H3 |
| InChIKey | IUHVKUUXUWFNRR-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.33 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |