C13H18BrNO4S — CID 103541087
[3-bromo-5-(3-methoxypyrrolidin-1-yl)sulfonyl-4-methylphenyl]methanol (PubChem CID 103541087) has the molecular formula C13H18BrNO4S and a molecular weight of 364.26 g/mol. Its IUPAC name is [3-bromo-5-(3-methoxypyrrolidin-1-yl)sulfonyl-4-methylphenyl]methanol.
| Compound Name | [3-bromo-5-(3-methoxypyrrolidin-1-yl)sulfonyl-4-methylphenyl]methanol |
|---|---|
| PubChem CID | 103541087 |
| Molecular Formula | C13H18BrNO4S |
| Molecular Weight | 364.26 g/mol |
| Exact Mass | 363.01 |
| IUPAC Name | [3-bromo-5-(3-methoxypyrrolidin-1-yl)sulfonyl-4-methylphenyl]methanol |
| SMILES | COC1CCN(S(=O)(=O)c2cc(CO)cc(Br)c2C)C1 |
| InChI | InChI=1S/C13H18BrNO4S/c1-9-12(14)5-10(8-16)6-13(9)20(17,18)15-4-3-11(7-15)19-2/h5-6,11,16H,3-4,7-8H2,1-2H3 |
| InChIKey | BBOQGRJKOHWOQW-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.26 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |