C14H18BrNO4S — CID 81480778
[3-bromo-4-methyl-5-(8-oxa-3-azabicyclo[3.2.1]octan-3-ylsulfonyl)phenyl]methanol (PubChem CID 81480778) has the molecular formula C14H18BrNO4S and a molecular weight of 376.27 g/mol. Its IUPAC name is [3-bromo-4-methyl-5-(8-oxa-3-azabicyclo[3.2.1]octan-3-ylsulfonyl)phenyl]methanol.
| Compound Name | [3-bromo-4-methyl-5-(8-oxa-3-azabicyclo[3.2.1]octan-3-ylsulfonyl)phenyl]methanol |
|---|---|
| PubChem CID | 81480778 |
| Molecular Formula | C14H18BrNO4S |
| Molecular Weight | 376.27 g/mol |
| Exact Mass | 375.01 |
| IUPAC Name | [3-bromo-4-methyl-5-(8-oxa-3-azabicyclo[3.2.1]octan-3-ylsulfonyl)phenyl]methanol |
| SMILES | Cc1c(Br)cc(CO)cc1S(=O)(=O)N1CC2CCC(C1)O2 |
| InChI | InChI=1S/C14H18BrNO4S/c1-9-13(15)4-10(8-17)5-14(9)21(18,19)16-6-11-2-3-12(7-16)20-11/h4-5,11-12,17H,2-3,6-8H2,1H3 |
| InChIKey | VDHGZAQJZFWGQU-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.27 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |