C12H15Br2NO3S — CID 45153824
4-(2,5-dibromophenyl)sulfonyl-2,6-dimethylmorpholine (PubChem CID 45153824) has the molecular formula C12H15Br2NO3S and a molecular weight of 413.13 g/mol. Its IUPAC name is 4-(2,5-dibromophenyl)sulfonyl-2,6-dimethylmorpholine.
| Compound Name | 4-(2,5-dibromophenyl)sulfonyl-2,6-dimethylmorpholine |
|---|---|
| PubChem CID | 45153824 |
| Molecular Formula | C12H15Br2NO3S |
| Molecular Weight | 413.13 g/mol |
| Exact Mass | 410.91 |
| IUPAC Name | 4-(2,5-dibromophenyl)sulfonyl-2,6-dimethylmorpholine |
| SMILES | CC1CN(S(=O)(=O)c2cc(Br)ccc2Br)CC(C)O1 |
| InChI | InChI=1S/C12H15Br2NO3S/c1-8-6-15(7-9(2)18-8)19(16,17)12-5-10(13)3-4-11(12)14/h3-5,8-9H,6-7H2,1-2H3 |
| InChIKey | RMOMRWHNHUFESX-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.13 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |