C13H18BrNO4S — CID 7366801
(2S,6S)-4-(4-bromo-3-methoxyphenyl)sulfonyl-2,6-dimethylmorpholine (PubChem CID 7366801) has the molecular formula C13H18BrNO4S and a molecular weight of 364.26 g/mol. Its IUPAC name is (2S,6S)-4-(4-bromo-3-methoxyphenyl)sulfonyl-2,6-dimethylmorpholine.
| Compound Name | (2S,6S)-4-(4-bromo-3-methoxyphenyl)sulfonyl-2,6-dimethylmorpholine |
|---|---|
| PubChem CID | 7366801 |
| Molecular Formula | C13H18BrNO4S |
| Molecular Weight | 364.26 g/mol |
| Exact Mass | 363.01 |
| IUPAC Name | (2S,6S)-4-(4-bromo-3-methoxyphenyl)sulfonyl-2,6-dimethylmorpholine |
| SMILES | COc1cc(S(=O)(=O)N2C[C@H](C)O[C@@H](C)C2)ccc1Br |
| InChI | InChI=1S/C13H18BrNO4S/c1-9-7-15(8-10(2)19-9)20(16,17)11-4-5-12(14)13(6-11)18-3/h4-6,9-10H,7-8H2,1-3H3/t9-,10-/m0/s1 |
| InChIKey | YZYPTUDBJTUPRY-UWVGGRQHSA-N |
| XLogP | 2.26 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.26 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |