C14H20BrNO4S — CID 1243645
(2S,6S)-4-(4-bromo-3-ethoxyphenyl)sulfonyl-2,6-dimethylmorpholine (PubChem CID 1243645) has the molecular formula C14H20BrNO4S and a molecular weight of 378.29 g/mol. Its IUPAC name is (2S,6S)-4-(4-bromo-3-ethoxyphenyl)sulfonyl-2,6-dimethylmorpholine.
| Compound Name | (2S,6S)-4-(4-bromo-3-ethoxyphenyl)sulfonyl-2,6-dimethylmorpholine |
|---|---|
| PubChem CID | 1243645 |
| Molecular Formula | C14H20BrNO4S |
| Molecular Weight | 378.29 g/mol |
| Exact Mass | 377.03 |
| IUPAC Name | (2S,6S)-4-(4-bromo-3-ethoxyphenyl)sulfonyl-2,6-dimethylmorpholine |
| SMILES | CCOc1cc(S(=O)(=O)N2C[C@H](C)O[C@@H](C)C2)ccc1Br |
| InChI | InChI=1S/C14H20BrNO4S/c1-4-19-14-7-12(5-6-13(14)15)21(17,18)16-8-10(2)20-11(3)9-16/h5-7,10-11H,4,8-9H2,1-3H3/t10-,11-/m0/s1 |
| InChIKey | POMZXPCROGGSES-QWRGUYRKSA-N |
| XLogP | 2.65 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.29 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |