C16H24ClNO4S — CID 35202783
(2R,6R)-4-(3-butoxy-4-chlorophenyl)sulfonyl-2,6-dimethylmorpholine (PubChem CID 35202783) has the molecular formula C16H24ClNO4S and a molecular weight of 361.89 g/mol. Its IUPAC name is (2R,6R)-4-(3-butoxy-4-chlorophenyl)sulfonyl-2,6-dimethylmorpholine.
| Compound Name | (2R,6R)-4-(3-butoxy-4-chlorophenyl)sulfonyl-2,6-dimethylmorpholine |
|---|---|
| PubChem CID | 35202783 |
| Molecular Formula | C16H24ClNO4S |
| Molecular Weight | 361.89 g/mol |
| Exact Mass | 361.11 |
| IUPAC Name | (2R,6R)-4-(3-butoxy-4-chlorophenyl)sulfonyl-2,6-dimethylmorpholine |
| SMILES | CCCCOc1cc(S(=O)(=O)N2C[C@@H](C)O[C@H](C)C2)ccc1Cl |
| InChI | InChI=1S/C16H24ClNO4S/c1-4-5-8-21-16-9-14(6-7-15(16)17)23(19,20)18-10-12(2)22-13(3)11-18/h6-7,9,12-13H,4-5,8,10-11H2,1-3H3/t12-,13-/m1/s1 |
| InChIKey | WJHOTURXGZALGT-CHWSQXEVSA-N |
| XLogP | 3.32 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.89 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|