C12H19BrN2O2S2 — CID 124517199
1-[(3S)-1-(5-bromo-2-methylthiophen-3-yl)sulfonylpiperidin-3-yl]-N-methylmethanamine (PubChem CID 124517199) has the molecular formula C12H19BrN2O2S2 and a molecular weight of 367.33 g/mol. Its IUPAC name is 1-[(3S)-1-(5-bromo-2-methylthiophen-3-yl)sulfonylpiperidin-3-yl]-N-methylmethanamine.
| Compound Name | 1-[(3S)-1-(5-bromo-2-methylthiophen-3-yl)sulfonylpiperidin-3-yl]-N-methylmethanamine |
|---|---|
| PubChem CID | 124517199 |
| Molecular Formula | C12H19BrN2O2S2 |
| Molecular Weight | 367.33 g/mol |
| Exact Mass | 366.01 |
| IUPAC Name | 1-[(3S)-1-(5-bromo-2-methylthiophen-3-yl)sulfonylpiperidin-3-yl]-N-methylmethanamine |
| SMILES | CNC[C@@H]1CCCN(S(=O)(=O)c2cc(Br)sc2C)C1 |
| InChI | InChI=1S/C12H19BrN2O2S2/c1-9-11(6-12(13)18-9)19(16,17)15-5-3-4-10(8-15)7-14-2/h6,10,14H,3-5,7-8H2,1-2H3/t10-/m0/s1 |
| InChIKey | ZDCAFSNKHTZQCO-JTQLQIEISA-N |
| XLogP | 2.44 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.33 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |