C15H23BrN2O3S — CID 124686441
1-[(3S)-1-(5-bromo-2-methoxy-4-methylphenyl)sulfonylpiperidin-3-yl]-N-methylmethanamine (PubChem CID 124686441) has the molecular formula C15H23BrN2O3S and a molecular weight of 391.33 g/mol. Its IUPAC name is 1-[(3S)-1-(5-bromo-2-methoxy-4-methylphenyl)sulfonylpiperidin-3-yl]-N-methylmethanamine.
| Compound Name | 1-[(3S)-1-(5-bromo-2-methoxy-4-methylphenyl)sulfonylpiperidin-3-yl]-N-methylmethanamine |
|---|---|
| PubChem CID | 124686441 |
| Molecular Formula | C15H23BrN2O3S |
| Molecular Weight | 391.33 g/mol |
| Exact Mass | 390.06 |
| IUPAC Name | 1-[(3S)-1-(5-bromo-2-methoxy-4-methylphenyl)sulfonylpiperidin-3-yl]-N-methylmethanamine |
| SMILES | CNC[C@@H]1CCCN(S(=O)(=O)c2cc(Br)c(C)cc2OC)C1 |
| InChI | InChI=1S/C15H23BrN2O3S/c1-11-7-14(21-3)15(8-13(11)16)22(19,20)18-6-4-5-12(10-18)9-17-2/h7-8,12,17H,4-6,9-10H2,1-3H3/t12-/m0/s1 |
| InChIKey | TVQUNPRIMUSJND-LBPRGKRZSA-N |
| XLogP | 2.39 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.33 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |