C16H16BrFN2O3S2 — CID 166234359
[4-(5-bromo-2-methylthiophen-3-yl)sulfonylpiperazin-1-yl]-(4-fluorophenyl)methanone (PubChem CID 166234359) has the molecular formula C16H16BrFN2O3S2 and a molecular weight of 447.35 g/mol. Its IUPAC name is [4-(5-bromo-2-methylthiophen-3-yl)sulfonylpiperazin-1-yl]-(4-fluorophenyl)methanone.
| Compound Name | [4-(5-bromo-2-methylthiophen-3-yl)sulfonylpiperazin-1-yl]-(4-fluorophenyl)methanone |
|---|---|
| PubChem CID | 166234359 |
| Molecular Formula | C16H16BrFN2O3S2 |
| Molecular Weight | 447.35 g/mol |
| Exact Mass | 445.98 |
| IUPAC Name | [4-(5-bromo-2-methylthiophen-3-yl)sulfonylpiperazin-1-yl]-(4-fluorophenyl)methanone |
| SMILES | Cc1sc(Br)cc1S(=O)(=O)N1CCN(C(=O)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C16H16BrFN2O3S2/c1-11-14(10-15(17)24-11)25(22,23)20-8-6-19(7-9-20)16(21)12-2-4-13(18)5-3-12/h2-5,10H,6-9H2,1H3 |
| InChIKey | WAIINVITWGPZHI-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.35 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |