C19H20FN3O5S — CID 78870369
(4-fluorophenyl)-[4-(2-methyl-4-nitrophenyl)sulfonyl-1,4-diazepan-1-yl]methanone (PubChem CID 78870369) has the molecular formula C19H20FN3O5S and a molecular weight of 421.45 g/mol. Its IUPAC name is (4-fluorophenyl)-[4-(2-methyl-4-nitrophenyl)sulfonyl-1,4-diazepan-1-yl]methanone.
| Compound Name | (4-fluorophenyl)-[4-(2-methyl-4-nitrophenyl)sulfonyl-1,4-diazepan-1-yl]methanone |
|---|---|
| PubChem CID | 78870369 |
| Molecular Formula | C19H20FN3O5S |
| Molecular Weight | 421.45 g/mol |
| Exact Mass | 421.11 |
| IUPAC Name | (4-fluorophenyl)-[4-(2-methyl-4-nitrophenyl)sulfonyl-1,4-diazepan-1-yl]methanone |
| SMILES | Cc1cc([N+](=O)[O-])ccc1S(=O)(=O)N1CCCN(C(=O)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C19H20FN3O5S/c1-14-13-17(23(25)26)7-8-18(14)29(27,28)22-10-2-9-21(11-12-22)19(24)15-3-5-16(20)6-4-15/h3-8,13H,2,9-12H2,1H3 |
| InChIKey | XPSRLPNRKFEYFK-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 100.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.45 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|