C17H16F2N4O5S — CID 46637228
[4-(2,4-difluorophenyl)sulfonylpiperazin-1-yl]-(2-methyl-5-nitro-3-pyridinyl)methanone (PubChem CID 46637228) has the molecular formula C17H16F2N4O5S and a molecular weight of 426.40 g/mol. Its IUPAC name is [4-(2,4-difluorophenyl)sulfonylpiperazin-1-yl]-(2-methyl-5-nitro-3-pyridinyl)methanone.
| Compound Name | [4-(2,4-difluorophenyl)sulfonylpiperazin-1-yl]-(2-methyl-5-nitro-3-pyridinyl)methanone |
|---|---|
| PubChem CID | 46637228 |
| Molecular Formula | C17H16F2N4O5S |
| Molecular Weight | 426.40 g/mol |
| Exact Mass | 426.08 |
| IUPAC Name | [4-(2,4-difluorophenyl)sulfonylpiperazin-1-yl]-(2-methyl-5-nitro-3-pyridinyl)methanone |
| SMILES | Cc1ncc([N+](=O)[O-])cc1C(=O)N1CCN(S(=O)(=O)c2ccc(F)cc2F)CC1 |
| InChI | InChI=1S/C17H16F2N4O5S/c1-11-14(9-13(10-20-11)23(25)26)17(24)21-4-6-22(7-5-21)29(27,28)16-3-2-12(18)8-15(16)19/h2-3,8-10H,4-7H2,1H3 |
| InChIKey | BVFGWGGJRCXWGR-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 113.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.40 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|