C17H16FN3O4 — CID 155945273
[2-(3-fluorophenyl)morpholin-4-yl]-(2-methyl-5-nitro-3-pyridinyl)methanone (PubChem CID 155945273) has the molecular formula C17H16FN3O4 and a molecular weight of 345.33 g/mol. Its IUPAC name is [2-(3-fluorophenyl)morpholin-4-yl]-(2-methyl-5-nitro-3-pyridinyl)methanone.
| Compound Name | [2-(3-fluorophenyl)morpholin-4-yl]-(2-methyl-5-nitro-3-pyridinyl)methanone |
|---|---|
| PubChem CID | 155945273 |
| Molecular Formula | C17H16FN3O4 |
| Molecular Weight | 345.33 g/mol |
| Exact Mass | 345.11 |
| IUPAC Name | [2-(3-fluorophenyl)morpholin-4-yl]-(2-methyl-5-nitro-3-pyridinyl)methanone |
| SMILES | Cc1ncc([N+](=O)[O-])cc1C(=O)N1CCOC(c2cccc(F)c2)C1 |
| InChI | InChI=1S/C17H16FN3O4/c1-11-15(8-14(9-19-11)21(23)24)17(22)20-5-6-25-16(10-20)12-3-2-4-13(18)7-12/h2-4,7-9,16H,5-6,10H2,1H3 |
| InChIKey | DQJDZBFISXWMHF-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 85.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.33 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|