C17H15Cl2N3O4 — CID 155969974
[2-(2,3-dichlorophenyl)morpholin-4-yl]-(2-methyl-5-nitro-3-pyridinyl)methanone (PubChem CID 155969974) has the molecular formula C17H15Cl2N3O4 and a molecular weight of 396.23 g/mol. Its IUPAC name is [2-(2,3-dichlorophenyl)morpholin-4-yl]-(2-methyl-5-nitro-3-pyridinyl)methanone.
| Compound Name | [2-(2,3-dichlorophenyl)morpholin-4-yl]-(2-methyl-5-nitro-3-pyridinyl)methanone |
|---|---|
| PubChem CID | 155969974 |
| Molecular Formula | C17H15Cl2N3O4 |
| Molecular Weight | 396.23 g/mol |
| Exact Mass | 395.04 |
| IUPAC Name | [2-(2,3-dichlorophenyl)morpholin-4-yl]-(2-methyl-5-nitro-3-pyridinyl)methanone |
| SMILES | Cc1ncc([N+](=O)[O-])cc1C(=O)N1CCOC(c2cccc(Cl)c2Cl)C1 |
| InChI | InChI=1S/C17H15Cl2N3O4/c1-10-13(7-11(8-20-10)22(24)25)17(23)21-5-6-26-15(9-21)12-3-2-4-14(18)16(12)19/h2-4,7-8,15H,5-6,9H2,1H3 |
| InChIKey | GNSZKZNGYWOIOY-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 85.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.23 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|