C17H13F3N4O7S — CID 26293291
(3,5-dinitrophenyl)-[4-(2,3,4-trifluorophenyl)sulfonylpiperazin-1-yl]methanone (PubChem CID 26293291) has the molecular formula C17H13F3N4O7S and a molecular weight of 474.37 g/mol. Its IUPAC name is (3,5-dinitrophenyl)-[4-(2,3,4-trifluorophenyl)sulfonylpiperazin-1-yl]methanone.
| Compound Name | (3,5-dinitrophenyl)-[4-(2,3,4-trifluorophenyl)sulfonylpiperazin-1-yl]methanone |
|---|---|
| PubChem CID | 26293291 |
| Molecular Formula | C17H13F3N4O7S |
| Molecular Weight | 474.37 g/mol |
| Exact Mass | 474.05 |
| IUPAC Name | (3,5-dinitrophenyl)-[4-(2,3,4-trifluorophenyl)sulfonylpiperazin-1-yl]methanone |
| SMILES | O=C(c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1)N1CCN(S(=O)(=O)c2ccc(F)c(F)c2F)CC1 |
| InChI | InChI=1S/C17H13F3N4O7S/c18-13-1-2-14(16(20)15(13)19)32(30,31)22-5-3-21(4-6-22)17(25)10-7-11(23(26)27)9-12(8-10)24(28)29/h1-2,7-9H,3-6H2 |
| InChIKey | OVNKDICJSKPAIN-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 143.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.37 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|