C20H21F3N2O5S2 — CID 55754351
(4-propan-2-ylsulfonylphenyl)-[4-(2,3,4-trifluorophenyl)sulfonylpiperazin-1-yl]methanone (PubChem CID 55754351) has the molecular formula C20H21F3N2O5S2 and a molecular weight of 490.53 g/mol. Its IUPAC name is (4-propan-2-ylsulfonylphenyl)-[4-(2,3,4-trifluorophenyl)sulfonylpiperazin-1-yl]methanone.
| Compound Name | (4-propan-2-ylsulfonylphenyl)-[4-(2,3,4-trifluorophenyl)sulfonylpiperazin-1-yl]methanone |
|---|---|
| PubChem CID | 55754351 |
| Molecular Formula | C20H21F3N2O5S2 |
| Molecular Weight | 490.53 g/mol |
| Exact Mass | 490.08 |
| IUPAC Name | (4-propan-2-ylsulfonylphenyl)-[4-(2,3,4-trifluorophenyl)sulfonylpiperazin-1-yl]methanone |
| SMILES | CC(C)S(=O)(=O)c1ccc(C(=O)N2CCN(S(=O)(=O)c3ccc(F)c(F)c3F)CC2)cc1 |
| InChI | InChI=1S/C20H21F3N2O5S2/c1-13(2)31(27,28)15-5-3-14(4-6-15)20(26)24-9-11-25(12-10-24)32(29,30)17-8-7-16(21)18(22)19(17)23/h3-8,13H,9-12H2,1-2H3 |
| InChIKey | TYIUIFALDONWQM-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 91.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.53 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|