C19H18ClF3N2O4S — CID 55344253
2-(4-chlorophenoxy)-1-[4-(2,3,4-trifluorophenyl)sulfonylpiperazin-1-yl]propan-1-one (PubChem CID 55344253) has the molecular formula C19H18ClF3N2O4S and a molecular weight of 462.88 g/mol. Its IUPAC name is 2-(4-chlorophenoxy)-1-[4-(2,3,4-trifluorophenyl)sulfonylpiperazin-1-yl]propan-1-one.
| Compound Name | 2-(4-chlorophenoxy)-1-[4-(2,3,4-trifluorophenyl)sulfonylpiperazin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 55344253 |
| Molecular Formula | C19H18ClF3N2O4S |
| Molecular Weight | 462.88 g/mol |
| Exact Mass | 462.06 |
| IUPAC Name | 2-(4-chlorophenoxy)-1-[4-(2,3,4-trifluorophenyl)sulfonylpiperazin-1-yl]propan-1-one |
| SMILES | CC(Oc1ccc(Cl)cc1)C(=O)N1CCN(S(=O)(=O)c2ccc(F)c(F)c2F)CC1 |
| InChI | InChI=1S/C19H18ClF3N2O4S/c1-12(29-14-4-2-13(20)3-5-14)19(26)24-8-10-25(11-9-24)30(27,28)16-7-6-15(21)17(22)18(16)23/h2-7,12H,8-11H2,1H3 |
| InChIKey | UCOTXDQVNYGYJH-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.88 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|