C15H12BrF3N2O4S — CID 26293314
(5-bromofuran-2-yl)-[4-(2,3,4-trifluorophenyl)sulfonylpiperazin-1-yl]methanone (PubChem CID 26293314) has the molecular formula C15H12BrF3N2O4S and a molecular weight of 453.24 g/mol. Its IUPAC name is (5-bromofuran-2-yl)-[4-(2,3,4-trifluorophenyl)sulfonylpiperazin-1-yl]methanone.
| Compound Name | (5-bromofuran-2-yl)-[4-(2,3,4-trifluorophenyl)sulfonylpiperazin-1-yl]methanone |
|---|---|
| PubChem CID | 26293314 |
| Molecular Formula | C15H12BrF3N2O4S |
| Molecular Weight | 453.24 g/mol |
| Exact Mass | 451.97 |
| IUPAC Name | (5-bromofuran-2-yl)-[4-(2,3,4-trifluorophenyl)sulfonylpiperazin-1-yl]methanone |
| SMILES | O=C(c1ccc(Br)o1)N1CCN(S(=O)(=O)c2ccc(F)c(F)c2F)CC1 |
| InChI | InChI=1S/C15H12BrF3N2O4S/c16-12-4-2-10(25-12)15(22)20-5-7-21(8-6-20)26(23,24)11-3-1-9(17)13(18)14(11)19/h1-4H,5-8H2 |
| InChIKey | IBDSBKFFGUCEJE-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 70.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.24 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|