C18H14F3N3O3S — CID 26558740
4-[4-(2,3,4-trifluorophenyl)sulfonylpiperazine-1-carbonyl]benzonitrile (PubChem CID 26558740) has the molecular formula C18H14F3N3O3S and a molecular weight of 409.39 g/mol. Its IUPAC name is 4-[4-(2,3,4-trifluorophenyl)sulfonylpiperazine-1-carbonyl]benzonitrile.
| Compound Name | 4-[4-(2,3,4-trifluorophenyl)sulfonylpiperazine-1-carbonyl]benzonitrile |
|---|---|
| PubChem CID | 26558740 |
| Molecular Formula | C18H14F3N3O3S |
| Molecular Weight | 409.39 g/mol |
| Exact Mass | 409.07 |
| IUPAC Name | 4-[4-(2,3,4-trifluorophenyl)sulfonylpiperazine-1-carbonyl]benzonitrile |
| SMILES | N#Cc1ccc(C(=O)N2CCN(S(=O)(=O)c3ccc(F)c(F)c3F)CC2)cc1 |
| InChI | InChI=1S/C18H14F3N3O3S/c19-14-5-6-15(17(21)16(14)20)28(26,27)24-9-7-23(8-10-24)18(25)13-3-1-12(11-22)2-4-13/h1-6H,7-10H2 |
| InChIKey | WJYYDCVZLWUSFR-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 81.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.39 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|