C13H15F3N2O4S — CID 122157219
3-[4-(2,3,4-trifluorophenyl)sulfonylpiperazin-1-yl]propanoic acid (PubChem CID 122157219) has the molecular formula C13H15F3N2O4S and a molecular weight of 352.33 g/mol. Its IUPAC name is 3-[4-(2,3,4-trifluorophenyl)sulfonylpiperazin-1-yl]propanoic acid.
| Compound Name | 3-[4-(2,3,4-trifluorophenyl)sulfonylpiperazin-1-yl]propanoic acid |
|---|---|
| PubChem CID | 122157219 |
| Molecular Formula | C13H15F3N2O4S |
| Molecular Weight | 352.33 g/mol |
| Exact Mass | 352.07 |
| IUPAC Name | 3-[4-(2,3,4-trifluorophenyl)sulfonylpiperazin-1-yl]propanoic acid |
| SMILES | O=C(O)CCN1CCN(S(=O)(=O)c2ccc(F)c(F)c2F)CC1 |
| InChI | InChI=1S/C13H15F3N2O4S/c14-9-1-2-10(13(16)12(9)15)23(21,22)18-7-5-17(6-8-18)4-3-11(19)20/h1-2H,3-8H2,(H,19,20) |
| InChIKey | FWHUPMOWTLJLOG-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.33 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|