C12H12F3NO5S — CID 135100519
(3S,4S)-4-hydroxy-1-(2,3,4-trifluorophenyl)sulfonylpiperidine-3-carboxylic acid (PubChem CID 135100519) has the molecular formula C12H12F3NO5S and a molecular weight of 339.29 g/mol. Its IUPAC name is (3S,4S)-4-hydroxy-1-(2,3,4-trifluorophenyl)sulfonylpiperidine-3-carboxylic acid.
| Compound Name | (3S,4S)-4-hydroxy-1-(2,3,4-trifluorophenyl)sulfonylpiperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 135100519 |
| Molecular Formula | C12H12F3NO5S |
| Molecular Weight | 339.29 g/mol |
| Exact Mass | 339.04 |
| IUPAC Name | (3S,4S)-4-hydroxy-1-(2,3,4-trifluorophenyl)sulfonylpiperidine-3-carboxylic acid |
| SMILES | O=C(O)[C@H]1CN(S(=O)(=O)c2ccc(F)c(F)c2F)CC[C@@H]1O |
| InChI | InChI=1S/C12H12F3NO5S/c13-7-1-2-9(11(15)10(7)14)22(20,21)16-4-3-8(17)6(5-16)12(18)19/h1-2,6,8,17H,3-5H2,(H,18,19)/t6-,8-/m0/s1 |
| InChIKey | CSUKUNGHIIVTFL-XPUUQOCRSA-N |
| XLogP | 0.56 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.29 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|