C10H12ClF3N2O2S — CID 120712583
(3S)-1-(2,3,4-trifluorophenyl)sulfonylpyrrolidin-3-amine;hydrochloride (PubChem CID 120712583) has the molecular formula C10H12ClF3N2O2S and a molecular weight of 316.73 g/mol. Its IUPAC name is (3S)-1-(2,3,4-trifluorophenyl)sulfonylpyrrolidin-3-amine;hydrochloride.
| Compound Name | (3S)-1-(2,3,4-trifluorophenyl)sulfonylpyrrolidin-3-amine;hydrochloride |
|---|---|
| PubChem CID | 120712583 |
| Molecular Formula | C10H12ClF3N2O2S |
| Molecular Weight | 316.73 g/mol |
| Exact Mass | 316.03 |
| IUPAC Name | (3S)-1-(2,3,4-trifluorophenyl)sulfonylpyrrolidin-3-amine;hydrochloride |
| SMILES | Cl.N[C@H]1CCN(S(=O)(=O)c2ccc(F)c(F)c2F)C1 |
| InChI | InChI=1S/C10H11F3N2O2S.ClH/c11-7-1-2-8(10(13)9(7)12)18(16,17)15-4-3-6(14)5-15;/h1-2,6H,3-5,14H2;1H/t6-;/m0./s1 |
| InChIKey | MHTNBFLQVKKOBC-RGMNGODLSA-N |
| XLogP | 1.25 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.73 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|