C12H17FN2O3S — CID 120706863
(3R)-1-(3-fluoro-4-methoxy-2-methylphenyl)sulfonylpyrrolidin-3-amine (PubChem CID 120706863) has the molecular formula C12H17FN2O3S and a molecular weight of 288.34 g/mol. Its IUPAC name is (3R)-1-(3-fluoro-4-methoxy-2-methylphenyl)sulfonylpyrrolidin-3-amine.
| Compound Name | (3R)-1-(3-fluoro-4-methoxy-2-methylphenyl)sulfonylpyrrolidin-3-amine |
|---|---|
| PubChem CID | 120706863 |
| Molecular Formula | C12H17FN2O3S |
| Molecular Weight | 288.34 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | (3R)-1-(3-fluoro-4-methoxy-2-methylphenyl)sulfonylpyrrolidin-3-amine |
| SMILES | COc1ccc(S(=O)(=O)N2CC[C@@H](N)C2)c(C)c1F |
| InChI | InChI=1S/C12H17FN2O3S/c1-8-11(4-3-10(18-2)12(8)13)19(16,17)15-6-5-9(14)7-15/h3-4,9H,5-7,14H2,1-2H3/t9-/m1/s1 |
| InChIKey | UWKFASTUTCRPHM-SECBINFHSA-N |
| XLogP | 0.86 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.34 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |