C13H21ClN2O5S2 — CID 120998796
1-(2-methoxy-5-methylsulfonylphenyl)sulfonylpiperidin-3-amine;hydrochloride (PubChem CID 120998796) has the molecular formula C13H21ClN2O5S2 and a molecular weight of 384.91 g/mol. Its IUPAC name is 1-(2-methoxy-5-methylsulfonylphenyl)sulfonylpiperidin-3-amine;hydrochloride.
| Compound Name | 1-(2-methoxy-5-methylsulfonylphenyl)sulfonylpiperidin-3-amine;hydrochloride |
|---|---|
| PubChem CID | 120998796 |
| Molecular Formula | C13H21ClN2O5S2 |
| Molecular Weight | 384.91 g/mol |
| Exact Mass | 384.06 |
| IUPAC Name | 1-(2-methoxy-5-methylsulfonylphenyl)sulfonylpiperidin-3-amine;hydrochloride |
| SMILES | COc1ccc(S(C)(=O)=O)cc1S(=O)(=O)N1CCCC(N)C1.Cl |
| InChI | InChI=1S/C13H20N2O5S2.ClH/c1-20-12-6-5-11(21(2,16)17)8-13(12)22(18,19)15-7-3-4-10(14)9-15;/h5-6,8,10H,3-4,7,9,14H2,1-2H3;1H |
| InChIKey | KMSPHXPBWHTITR-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 106.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.91 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |