C11H15BrN2O4S2 — CID 129380794
(3S)-1-(2-bromo-5-methylsulfonylphenyl)sulfonylpyrrolidin-3-amine (PubChem CID 129380794) has the molecular formula C11H15BrN2O4S2 and a molecular weight of 383.29 g/mol. Its IUPAC name is (3S)-1-(2-bromo-5-methylsulfonylphenyl)sulfonylpyrrolidin-3-amine.
| Compound Name | (3S)-1-(2-bromo-5-methylsulfonylphenyl)sulfonylpyrrolidin-3-amine |
|---|---|
| PubChem CID | 129380794 |
| Molecular Formula | C11H15BrN2O4S2 |
| Molecular Weight | 383.29 g/mol |
| Exact Mass | 381.97 |
| IUPAC Name | (3S)-1-(2-bromo-5-methylsulfonylphenyl)sulfonylpyrrolidin-3-amine |
| SMILES | CS(=O)(=O)c1ccc(Br)c(S(=O)(=O)N2CC[C@H](N)C2)c1 |
| InChI | InChI=1S/C11H15BrN2O4S2/c1-19(15,16)9-2-3-10(12)11(6-9)20(17,18)14-5-4-8(13)7-14/h2-3,6,8H,4-5,7,13H2,1H3/t8-/m0/s1 |
| InChIKey | ILPVWWNBTMHOIK-QMMMGPOBSA-N |
| XLogP | 0.57 |
| TPSA | 97.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.29 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |