C10H12BrFN2O2S — CID 55030126
1-(2-bromo-4-fluorophenyl)sulfonylpyrrolidin-3-amine (PubChem CID 55030126) has the molecular formula C10H12BrFN2O2S and a molecular weight of 323.19 g/mol. Its IUPAC name is 1-(2-bromo-4-fluorophenyl)sulfonylpyrrolidin-3-amine.
| Compound Name | 1-(2-bromo-4-fluorophenyl)sulfonylpyrrolidin-3-amine |
|---|---|
| PubChem CID | 55030126 |
| Molecular Formula | C10H12BrFN2O2S |
| Molecular Weight | 323.19 g/mol |
| Exact Mass | 321.98 |
| IUPAC Name | 1-(2-bromo-4-fluorophenyl)sulfonylpyrrolidin-3-amine |
| SMILES | NC1CCN(S(=O)(=O)c2ccc(F)cc2Br)C1 |
| InChI | InChI=1S/C10H12BrFN2O2S/c11-9-5-7(12)1-2-10(9)17(15,16)14-4-3-8(13)6-14/h1-2,5,8H,3-4,6,13H2 |
| InChIKey | WUPXZDWGFPSPAE-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.19 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |