C13H17BrFNO2S — CID 113254437
1-(2-bromo-4-fluorophenyl)sulfonyl-3-propan-2-ylpyrrolidine (PubChem CID 113254437) has the molecular formula C13H17BrFNO2S and a molecular weight of 350.25 g/mol. Its IUPAC name is 1-(2-bromo-4-fluorophenyl)sulfonyl-3-propan-2-ylpyrrolidine.
| Compound Name | 1-(2-bromo-4-fluorophenyl)sulfonyl-3-propan-2-ylpyrrolidine |
|---|---|
| PubChem CID | 113254437 |
| Molecular Formula | C13H17BrFNO2S |
| Molecular Weight | 350.25 g/mol |
| Exact Mass | 349.01 |
| IUPAC Name | 1-(2-bromo-4-fluorophenyl)sulfonyl-3-propan-2-ylpyrrolidine |
| SMILES | CC(C)C1CCN(S(=O)(=O)c2ccc(F)cc2Br)C1 |
| InChI | InChI=1S/C13H17BrFNO2S/c1-9(2)10-5-6-16(8-10)19(17,18)13-4-3-11(15)7-12(13)14/h3-4,7,9-10H,5-6,8H2,1-2H3 |
| InChIKey | LEMRMQWOVITTCO-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.25 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |