C14H21BrClFN2O2S — CID 119990532
N-[[1-(2-bromo-4-fluorophenyl)sulfonylpiperidin-4-yl]methyl]ethanamine;hydrochloride (PubChem CID 119990532) has the molecular formula C14H21BrClFN2O2S and a molecular weight of 415.76 g/mol. Its IUPAC name is N-[[1-(2-bromo-4-fluorophenyl)sulfonylpiperidin-4-yl]methyl]ethanamine;hydrochloride.
| Compound Name | N-[[1-(2-bromo-4-fluorophenyl)sulfonylpiperidin-4-yl]methyl]ethanamine;hydrochloride |
|---|---|
| PubChem CID | 119990532 |
| Molecular Formula | C14H21BrClFN2O2S |
| Molecular Weight | 415.76 g/mol |
| Exact Mass | 414.02 |
| IUPAC Name | N-[[1-(2-bromo-4-fluorophenyl)sulfonylpiperidin-4-yl]methyl]ethanamine;hydrochloride |
| SMILES | CCNCC1CCN(S(=O)(=O)c2ccc(F)cc2Br)CC1.Cl |
| InChI | InChI=1S/C14H20BrFN2O2S.ClH/c1-2-17-10-11-5-7-18(8-6-11)21(19,20)14-4-3-12(16)9-13(14)15;/h3-4,9,11,17H,2,5-8,10H2,1H3;1H |
| InChIKey | ZVEHIJSKRRTYIC-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.76 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |