C15H24ClFN2O3S — CID 120710861
1-[1-(3-fluoro-4-methoxy-2-methylphenyl)sulfonylpiperidin-3-yl]ethanamine;hydrochloride (PubChem CID 120710861) has the molecular formula C15H24ClFN2O3S and a molecular weight of 366.89 g/mol. Its IUPAC name is 1-[1-(3-fluoro-4-methoxy-2-methylphenyl)sulfonylpiperidin-3-yl]ethanamine;hydrochloride.
| Compound Name | 1-[1-(3-fluoro-4-methoxy-2-methylphenyl)sulfonylpiperidin-3-yl]ethanamine;hydrochloride |
|---|---|
| PubChem CID | 120710861 |
| Molecular Formula | C15H24ClFN2O3S |
| Molecular Weight | 366.89 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | 1-[1-(3-fluoro-4-methoxy-2-methylphenyl)sulfonylpiperidin-3-yl]ethanamine;hydrochloride |
| SMILES | COc1ccc(S(=O)(=O)N2CCCC(C(C)N)C2)c(C)c1F.Cl |
| InChI | InChI=1S/C15H23FN2O3S.ClH/c1-10-14(7-6-13(21-3)15(10)16)22(19,20)18-8-4-5-12(9-18)11(2)17;/h6-7,11-12H,4-5,8-9,17H2,1-3H3;1H |
| InChIKey | GAGWJLYDRMTTKL-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.89 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |