C15H24N2O4S — CID 120710896
1-[1-(2,6-dimethoxyphenyl)sulfonylpiperidin-3-yl]ethanamine (PubChem CID 120710896) has the molecular formula C15H24N2O4S and a molecular weight of 328.43 g/mol. Its IUPAC name is 1-[1-(2,6-dimethoxyphenyl)sulfonylpiperidin-3-yl]ethanamine.
| Compound Name | 1-[1-(2,6-dimethoxyphenyl)sulfonylpiperidin-3-yl]ethanamine |
|---|---|
| PubChem CID | 120710896 |
| Molecular Formula | C15H24N2O4S |
| Molecular Weight | 328.43 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | 1-[1-(2,6-dimethoxyphenyl)sulfonylpiperidin-3-yl]ethanamine |
| SMILES | COc1cccc(OC)c1S(=O)(=O)N1CCCC(C(C)N)C1 |
| InChI | InChI=1S/C15H24N2O4S/c1-11(16)12-6-5-9-17(10-12)22(18,19)15-13(20-2)7-4-8-14(15)21-3/h4,7-8,11-12H,5-6,9-10,16H2,1-3H3 |
| InChIKey | UZHIKIAGDQQWHN-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.43 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |