C17H22N2O4S2 — CID 119984570
methyl 3-[3-(1-aminoethyl)piperidin-1-yl]sulfonyl-1-benzothiophene-2-carboxylate (PubChem CID 119984570) has the molecular formula C17H22N2O4S2 and a molecular weight of 382.51 g/mol. Its IUPAC name is methyl 3-[3-(1-aminoethyl)piperidin-1-yl]sulfonyl-1-benzothiophene-2-carboxylate.
| Compound Name | methyl 3-[3-(1-aminoethyl)piperidin-1-yl]sulfonyl-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 119984570 |
| Molecular Formula | C17H22N2O4S2 |
| Molecular Weight | 382.51 g/mol |
| Exact Mass | 382.10 |
| IUPAC Name | methyl 3-[3-(1-aminoethyl)piperidin-1-yl]sulfonyl-1-benzothiophene-2-carboxylate |
| SMILES | COC(=O)c1sc2ccccc2c1S(=O)(=O)N1CCCC(C(C)N)C1 |
| InChI | InChI=1S/C17H22N2O4S2/c1-11(18)12-6-5-9-19(10-12)25(21,22)16-13-7-3-4-8-14(13)24-15(16)17(20)23-2/h3-4,7-8,11-12H,5-6,9-10,18H2,1-2H3 |
| InChIKey | NISKPWVZPZSWHG-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.51 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |