C15H17NO4S2 — CID 20944590
methyl 3-piperidin-1-ylsulfonyl-1-benzothiophene-2-carboxylate (PubChem CID 20944590) has the molecular formula C15H17NO4S2 and a molecular weight of 339.44 g/mol. Its IUPAC name is methyl 3-piperidin-1-ylsulfonyl-1-benzothiophene-2-carboxylate.
| Compound Name | methyl 3-piperidin-1-ylsulfonyl-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 20944590 |
| Molecular Formula | C15H17NO4S2 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.06 |
| IUPAC Name | methyl 3-piperidin-1-ylsulfonyl-1-benzothiophene-2-carboxylate |
| SMILES | COC(=O)c1sc2ccccc2c1S(=O)(=O)N1CCCCC1 |
| InChI | InChI=1S/C15H17NO4S2/c1-20-15(17)13-14(11-7-3-4-8-12(11)21-13)22(18,19)16-9-5-2-6-10-16/h3-4,7-8H,2,5-6,9-10H2,1H3 |
| InChIKey | GAUQPPFLYFQWDN-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |