C15H19ClN2O4S2 — CID 119974413
methyl 3-(pyrrolidin-2-ylmethylsulfamoyl)-1-benzothiophene-2-carboxylate;hydrochloride (PubChem CID 119974413) has the molecular formula C15H19ClN2O4S2 and a molecular weight of 390.91 g/mol. Its IUPAC name is methyl 3-(pyrrolidin-2-ylmethylsulfamoyl)-1-benzothiophene-2-carboxylate;hydrochloride.
| Compound Name | methyl 3-(pyrrolidin-2-ylmethylsulfamoyl)-1-benzothiophene-2-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 119974413 |
| Molecular Formula | C15H19ClN2O4S2 |
| Molecular Weight | 390.91 g/mol |
| Exact Mass | 390.05 |
| IUPAC Name | methyl 3-(pyrrolidin-2-ylmethylsulfamoyl)-1-benzothiophene-2-carboxylate;hydrochloride |
| SMILES | COC(=O)c1sc2ccccc2c1S(=O)(=O)NCC1CCCN1.Cl |
| InChI | InChI=1S/C15H18N2O4S2.ClH/c1-21-15(18)13-14(11-6-2-3-7-12(11)22-13)23(19,20)17-9-10-5-4-8-16-10;/h2-3,6-7,10,16-17H,4-5,8-9H2,1H3;1H |
| InChIKey | USTIPLAHPYJGRL-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.91 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |